C20H28N6O7P+ — CID 130312749
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-[[2-(2-ethylbutoxy)-2-oxoethyl]amino]-oxophosphanium (PubChem CID 130312749) has the molecular formula C20H28N6O7P+ and a molecular weight of 495.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-[[2-(2-ethylbutoxy)-2-oxoethyl]amino]-oxophosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-[[2-(2-ethylbutoxy)-2-oxoethyl]amino]-oxophosphanium |
|---|---|
| PubChem CID | 130312749 |
| Molecular Formula | C20H28N6O7P+ |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-[[2-(2-ethylbutoxy)-2-oxoethyl]amino]-oxophosphanium |
| SMILES | CCC(CC)COC(=O)CN[P+](=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H28N6O7P/c1-3-12(4-2)8-31-16(27)7-25-34(30)32-9-14-17(28)18(29)20(10-21,33-14)15-6-5-13-19(22)23-11-24-26(13)15/h5-6,11-12,14,17-18,28-29H,3-4,7-9H2,1-2H3,(H,25,30)(H2,22,23,24)/q+1/t14-,17-,18-,20+/m1/s1 |
| InChIKey | ALSBNJBRUHPHAZ-ZESCBINXSA-N |
| XLogP | 0.39 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|