C17H16N6O6P+ — CID 168915147
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-pyridin-3-yloxyphosphanium (PubChem CID 168915147) has the molecular formula C17H16N6O6P+ and a molecular weight of 431.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-pyridin-3-yloxyphosphanium.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-pyridin-3-yloxyphosphanium |
|---|---|
| PubChem CID | 168915147 |
| Molecular Formula | C17H16N6O6P+ |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-oxo-pyridin-3-yloxyphosphanium |
| SMILES | N#C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CO[P+](=O)Oc2cccnc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H16N6O6P/c18-8-17(13-4-3-11-16(19)21-9-22-23(11)13)15(25)14(24)12(28-17)7-27-30(26)29-10-2-1-5-20-6-10/h1-6,9,12,14-15,24-25H,7H2,(H2,19,21,22)/q+1/t12-,14-,15-,17+/m1/s1 |
| InChIKey | AIKCNZRXZXDUCQ-MMTVNHQJSA-N |
| XLogP | 0.30 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|