C19H24N4O6 — CID 170197137
[(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclopentylmethyl carbonate (PubChem CID 170197137) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclopentylmethyl carbonate.
| Compound Name | [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclopentylmethyl carbonate |
|---|---|
| PubChem CID | 170197137 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(1R,3S,4R,5S)-3-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4,5-dihydroxy-3-methyl-2-oxabicyclo[3.1.0]hexan-6-yl] cyclopentylmethyl carbonate |
| SMILES | C[C@@]1(c2ccc3c(N)ncnn23)O[C@@H]2C(OC(=O)OCC3CCCC3)[C@]2(O)[C@H]1O |
| InChI | InChI=1S/C19H24N4O6/c1-18(12-7-6-11-15(20)21-9-22-23(11)12)16(24)19(26)13(14(19)29-18)28-17(25)27-8-10-4-2-3-5-10/h6-7,9-10,13-14,16,24,26H,2-5,8H2,1H3,(H2,20,21,22)/t13?,14-,16+,18+,19-/m1/s1 |
| InChIKey | MYOQKJQZLGREMI-ZSUQLIOTSA-N |
| XLogP | 0.74 |
| TPSA | 141.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |