C18H24N6O4 — CID 167155712
[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylpentanoate (PubChem CID 167155712) has the molecular formula C18H24N6O4 and a molecular weight of 388.43 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylpentanoate.
| Compound Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 167155712 |
| Molecular Formula | C18H24N6O4 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methyl (2S)-2-amino-3-methylpentanoate |
| SMILES | CCC(C)[C@H](N)C(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)C[C@@H]1O |
| InChI | InChI=1S/C18H24N6O4/c1-3-10(2)15(20)17(26)27-7-13-12(25)6-18(8-19,28-13)14-5-4-11-16(21)22-9-23-24(11)14/h4-5,9-10,12-13,15,25H,3,6-7,20H2,1-2H3,(H2,21,22,23)/t10?,12-,13+,15-,18-/m0/s1 |
| InChIKey | XMOVXVPNVUBECC-RFQRJHDSSA-N |
| XLogP | 0.10 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |