C18H21N5O7 — CID 174111499
5-[[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methoxycarbonyloxy]pentanoic acid (PubChem CID 174111499) has the molecular formula C18H21N5O7 and a molecular weight of 419.39 g/mol. Its IUPAC name is 5-[[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methoxycarbonyloxy]pentanoic acid.
| Compound Name | 5-[[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methoxycarbonyloxy]pentanoic acid |
|---|---|
| PubChem CID | 174111499 |
| Molecular Formula | C18H21N5O7 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-[[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3-hydroxyoxolan-2-yl]methoxycarbonyloxy]pentanoic acid |
| SMILES | N#C[C@]1(c2ccc3c(N)ncnn23)C[C@H](O)[C@@H](COC(=O)OCCCCC(=O)O)O1 |
| InChI | InChI=1S/C18H21N5O7/c19-9-18(14-5-4-11-16(20)21-10-22-23(11)14)7-12(24)13(30-18)8-29-17(27)28-6-2-1-3-15(25)26/h4-5,10,12-13,24H,1-3,6-8H2,(H,25,26)(H2,20,21,22)/t12-,13+,18-/m0/s1 |
| InChIKey | COWSXZMUGKRSMK-JCGVRSQUSA-N |
| XLogP | 0.59 |
| TPSA | 182.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|