C29H39N6O8P — CID 166913840
2-methoxypropyl (2S)-2-[[[(2S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate (PubChem CID 166913840) has the molecular formula C29H39N6O8P and a molecular weight of 630.64 g/mol. Its IUPAC name is 2-methoxypropyl (2S)-2-[[[(2S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | 2-methoxypropyl (2S)-2-[[[(2S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166913840 |
| Molecular Formula | C29H39N6O8P |
| Molecular Weight | 630.64 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | 2-methoxypropyl (2S)-2-[[[(2S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-hydroxyoxolan-2-yl]methoxy-(4-tert-butylphenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(C)COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C[C@@H](O)[C@](C#N)(c2ccc3c(N)ncnn23)O1)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H39N6O8P/c1-18(39-6)14-40-27(37)19(2)34-44(38,43-21-9-7-20(8-10-21)28(3,4)5)41-15-22-13-25(36)29(16-30,42-22)24-12-11-23-26(31)32-17-33-35(23)24/h7-12,17-19,22,25,36H,13-15H2,1-6H3,(H,34,38)(H2,31,32,33)/t18?,19-,22-,25+,29-,44?/m0/s1 |
| InChIKey | JSONBHUFLRHQFO-CBCKJJNBSA-N |
| XLogP | 3.24 |
| TPSA | 192.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.64 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|