C28H38N5O8P — CID 145387903
2-ethylbutyl (2S)-2-[[[(2S,5S,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6,7-dihydroxy-5-methyl-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 145387903) has the molecular formula C28H38N5O8P and a molecular weight of 603.61 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2S,5S,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6,7-dihydroxy-5-methyl-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2S,5S,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6,7-dihydroxy-5-methyl-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145387903 |
| Molecular Formula | C28H38N5O8P |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2S,5S,6R,7S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-6,7-dihydroxy-5-methyl-4-oxaspiro[2.4]heptan-2-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(Oc1ccccc1)O[C@H]1CC12O[C@@](C)(c1ccc3c(N)ncnn13)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C28H38N5O8P/c1-5-18(6-2)15-38-26(36)17(3)32-42(37,39-19-10-8-7-9-11-19)40-22-14-28(22)24(35)23(34)27(4,41-28)21-13-12-20-25(29)30-16-31-33(20)21/h7-13,16-18,22-24,34-35H,5-6,14-15H2,1-4H3,(H,32,37)(H2,29,30,31)/t17-,22-,23+,24-,27-,28?,42?/m0/s1 |
| InChIKey | ABDRURGXTKAIHC-ZOOMCUOQSA-N |
| XLogP | 2.95 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|