C26H37N2O8P — CID 177364823
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-2-methyl-5-pyridin-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 177364823) has the molecular formula C26H37N2O8P and a molecular weight of 536.56 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-2-methyl-5-pyridin-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-2-methyl-5-pyridin-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177364823 |
| Molecular Formula | C26H37N2O8P |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-2-methyl-5-pyridin-2-yloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(C)O[C@@H](c2ccccn2)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C26H37N2O8P/c1-5-19(6-2)16-33-25(31)18(3)28-37(32,36-20-12-8-7-9-13-20)34-17-26(4)24(30)22(29)23(35-26)21-14-10-11-15-27-21/h7-15,18-19,22-24,29-30H,5-6,16-17H2,1-4H3,(H,28,32)/t18-,22-,23-,24-,26+,37-/m0/s1 |
| InChIKey | SNNCRKJIJFMFKV-SJZVTFQDSA-N |
| XLogP | 3.79 |
| TPSA | 136.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|