C30H42NO8P — CID 177365017
2-ethylbutyl (2S)-2-[[[(3aS,4R,6S,6aS)-2,2,4-trimethyl-6-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 177365017) has the molecular formula C30H42NO8P and a molecular weight of 575.64 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(3aS,4R,6S,6aS)-2,2,4-trimethyl-6-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(3aS,4R,6S,6aS)-2,2,4-trimethyl-6-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 177365017 |
| Molecular Formula | C30H42NO8P |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(3aS,4R,6S,6aS)-2,2,4-trimethyl-6-phenyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@@]1(C)O[C@@H](c2ccccc2)[C@@H]2OC(C)(C)O[C@@H]21)Oc1ccccc1 |
| InChI | InChI=1S/C30H42NO8P/c1-7-22(8-2)19-34-28(32)21(3)31-40(33,39-24-17-13-10-14-18-24)35-20-30(6)27-26(36-29(4,5)38-27)25(37-30)23-15-11-9-12-16-23/h9-18,21-22,25-27H,7-8,19-20H2,1-6H3,(H,31,33)/t21-,25-,26-,27-,30+,40-/m0/s1 |
| InChIKey | ISMAIZIFDQAADF-FLHPAHHESA-N |
| XLogP | 6.20 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|