C28H42N5O8P — CID 139477361
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyl-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 139477361) has the molecular formula C28H42N5O8P and a molecular weight of 607.65 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyl-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyl-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 139477361 |
| Molecular Formula | C28H42N5O8P |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5S)-3,4-dihydroxy-5-methyl-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=Nn1c(/C(N)=N/C)ccc1[C@]1(C)O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(CC)CC)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C28H42N5O8P/c1-7-19(8-2)16-38-27(36)18(3)32-42(37,41-20-12-10-9-11-13-20)39-17-22-24(34)25(35)28(4,40-22)23-15-14-21(26(29)30-5)33(23)31-6/h9-15,18-19,22,24-25,34-35H,6-8,16-17H2,1-5H3,(H2,29,30)(H,32,37)/t18-,22+,24+,25+,28-,42?/m0/s1 |
| InChIKey | JKQHSNPKIRORRQ-BWYRJIPMSA-N |
| XLogP | 2.78 |
| TPSA | 179.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|