C28H40N5O8P — CID 148879280
2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-1,2,3,4-tetrahydropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 148879280) has the molecular formula C28H40N5O8P and a molecular weight of 605.63 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-1,2,3,4-tetrahydropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-1,2,3,4-tetrahydropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 148879280 |
| Molecular Formula | C28H40N5O8P |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[[(2R,3S,4R,5R)-5-(4-amino-1,2,3,4-tetrahydropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3n2NCCC3N)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C28H40N5O8P/c1-4-19(5-2)15-38-27(36)18(3)32-42(37,41-20-9-7-6-8-10-20)39-16-23-25(34)26(35)28(17-29,40-23)24-12-11-22-21(30)13-14-31-33(22)24/h6-12,18-19,21,23,25-26,31,34-35H,4-5,13-16,30H2,1-3H3,(H,32,37)/t18-,21?,23+,25+,26+,28-,42?/m0/s1 |
| InChIKey | PCSQVLRASCPFMZ-YEOVAHDMSA-N |
| XLogP | 2.44 |
| TPSA | 190.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|