C24H31N6O8P — CID 138525637
ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 138525637) has the molecular formula C24H31N6O8P and a molecular weight of 562.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 138525637 |
| Molecular Formula | C24H31N6O8P |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-5-cyano-3,4-dihydroxy-5-[5-(N'-methylcarbamimidoyl)-1-(methylideneamino)pyrrol-2-yl]oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=Nn1c(/C(N)=N/C)ccc1[C@]1(C#N)O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC)Oc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H31N6O8P/c1-5-35-23(33)15(2)29-39(34,38-16-9-7-6-8-10-16)36-13-18-20(31)21(32)24(14-25,37-18)19-12-11-17(22(26)27-3)30(19)28-4/h6-12,15,18,20-21,31-32H,4-5,13H2,1-3H3,(H2,26,27)(H,29,34)/t15-,18+,20+,21+,24-,39?/m0/s1 |
| InChIKey | SUDUVFINQZFXBX-XBIBZECMSA-N |
| XLogP | 0.87 |
| TPSA | 203.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|