C22H31N2O7P — CID 163535097
4-[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxy-N-methoxybenzeneamine oxide (PubChem CID 163535097) has the molecular formula C22H31N2O7P and a molecular weight of 466.47 g/mol. Its IUPAC name is 4-[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxy-N-methoxybenzeneamine oxide.
| Compound Name | 4-[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxy-N-methoxybenzeneamine oxide |
|---|---|
| PubChem CID | 163535097 |
| Molecular Formula | C22H31N2O7P |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 4-[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxy-N-methoxybenzeneamine oxide |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(Oc1ccccc1)Oc1ccc([NH+]([O-])OC)cc1 |
| InChI | InChI=1S/C22H31N2O7P/c1-5-18(6-2)16-29-22(25)17(3)23-32(27,30-20-10-8-7-9-11-20)31-21-14-12-19(13-15-21)24(26)28-4/h7-15,17-18,24H,5-6,16H2,1-4H3,(H,23,27)/t17-,32-/m0/s1 |
| InChIKey | DWGHIDSDHSEWRW-IQVDJAOASA-N |
| XLogP | 3.79 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|