C23H27F5NO5P — CID 167342678
2-ethylbutyl (2S)-2-[[(2,6-dimethylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 167342678) has the molecular formula C23H27F5NO5P and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[(2,6-dimethylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[(2,6-dimethylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 167342678 |
| Molecular Formula | C23H27F5NO5P |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[(2,6-dimethylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(Oc1c(C)cccc1C)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H27F5NO5P/c1-6-15(7-2)11-32-23(30)14(5)29-35(31,33-21-12(3)9-8-10-13(21)4)34-22-19(27)17(25)16(24)18(26)20(22)28/h8-10,14-15H,6-7,11H2,1-5H3,(H,29,31)/t14-,35?/m0/s1 |
| InChIKey | IROIPLJVWSNLPQ-XZRDNQIKSA-N |
| XLogP | 6.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|