C21H23F5NO4P — CID 168841280
2-ethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenyl)-phenoxyphosphoryl]amino]propanoate (PubChem CID 168841280) has the molecular formula C21H23F5NO4P and a molecular weight of 479.38 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenyl)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenyl)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 168841280 |
| Molecular Formula | C21H23F5NO4P |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenyl)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)N[P@](=O)(Oc1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H23F5NO4P/c1-4-13(5-2)11-30-21(28)12(3)27-32(29,31-14-9-7-6-8-10-14)20-18(25)16(23)15(22)17(24)19(20)26/h6-10,12-13H,4-5,11H2,1-3H3,(H,27,29)/t12-,32+/m0/s1 |
| InChIKey | SJRDHEHNDOOZPQ-PYFHWHSVSA-N |
| XLogP | 5.24 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|