C19H30N3O8P — CID 156835206
methyl (2S)-2-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 156835206) has the molecular formula C19H30N3O8P and a molecular weight of 459.44 g/mol. Its IUPAC name is methyl (2S)-2-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835206 |
| Molecular Formula | C19H30N3O8P |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | methyl (2S)-2-[[[[(2S)-1-(2-ethylbutoxy)-1-oxopropan-2-yl]amino]-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(N[C@@H](C)C(=O)OC)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H30N3O8P/c1-6-15(7-2)12-29-19(24)14(4)21-31(27,20-13(3)18(23)28-5)30-17-10-8-16(9-11-17)22(25)26/h8-11,13-15H,6-7,12H2,1-5H3,(H2,20,21,27)/t13-,14-,31?/m0/s1 |
| InChIKey | OLSVGVTYIHTZLX-ASXYJLNVSA-N |
| XLogP | 3.19 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|