C18H18BrN2O9P — CID 156758275
dimethyl (2S)-2-[[(4-bromophenoxy)-(4-nitrophenoxy)phosphoryl]amino]butanedioate (PubChem CID 156758275) has the molecular formula C18H18BrN2O9P and a molecular weight of 517.23 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(4-bromophenoxy)-(4-nitrophenoxy)phosphoryl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[(4-bromophenoxy)-(4-nitrophenoxy)phosphoryl]amino]butanedioate |
|---|---|
| PubChem CID | 156758275 |
| Molecular Formula | C18H18BrN2O9P |
| Molecular Weight | 517.23 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | dimethyl (2S)-2-[[(4-bromophenoxy)-(4-nitrophenoxy)phosphoryl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](NP(=O)(Oc1ccc(Br)cc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC |
| InChI | InChI=1S/C18H18BrN2O9P/c1-27-17(22)11-16(18(23)28-2)20-31(26,29-14-7-3-12(19)4-8-14)30-15-9-5-13(6-10-15)21(24)25/h3-10,16H,11H2,1-2H3,(H,20,26)/t16-,31?/m0/s1 |
| InChIKey | WNWNOXVFPOFEKV-YDIHDLSKSA-N |
| XLogP | 3.62 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.23 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|