C24H30N7O8P — CID 156627066
propan-2-yl (2S)-2-[[[(2R,4S,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 156627066) has the molecular formula C24H30N7O8P and a molecular weight of 575.52 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,4S,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,4S,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156627066 |
| Molecular Formula | C24H30N7O8P |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,4S,5S)-5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(N[C@@H](C)C(=O)OC(C)C)Oc2ccccc2)O[C@@H](c2cnc3c(N)nc(N)nn23)[C@@H](O)C1O |
| InChI | InChI=1S/C24H30N7O8P/c1-5-24(19(33)17(32)18(38-24)16-11-27-21-20(25)28-23(26)29-31(16)21)12-36-40(35,39-15-9-7-6-8-10-15)30-14(4)22(34)37-13(2)3/h1,6-11,13-14,17-19,32-33H,12H2,2-4H3,(H,30,35)(H4,25,26,28,29)/t14-,17+,18-,19?,24+,40-/m0/s1 |
| InChIKey | BIDPEHVLBJTZFY-SEWILUGUSA-N |
| XLogP | 0.59 |
| TPSA | 218.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|