C34H40FN6O7P — CID 174205224
heptan-4-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 174205224) has the molecular formula C34H40FN6O7P and a molecular weight of 694.70 g/mol. Its IUPAC name is heptan-4-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | heptan-4-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 174205224 |
| Molecular Formula | C34H40FN6O7P |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | heptan-4-yl 2-[[[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | C#C[C@]1(CO[P@@](=O)(NC(Cc2ccccc2)C(=O)OC(CCC)CCC)Oc2ccccc2)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C34H40FN6O7P/c1-4-13-24(14-5-2)46-32(43)26(19-23-15-9-7-10-16-23)40-49(44,48-25-17-11-8-12-18-25)45-21-34(6-3)27(42)20-28(47-34)41-22-37-29-30(36)38-33(35)39-31(29)41/h3,7-12,15-18,22,24,26-28,42H,4-5,13-14,19-21H2,1-2H3,(H,40,44)(H2,36,38,39)/t26?,27-,28+,34+,49-/m0/s1 |
| InChIKey | QPZTYHIZBJSRGN-VSESHZINSA-N |
| XLogP | 5.12 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|