C20H18N2O4 — CID 118081965
[(2R,5R)-5-ethynyl-2-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)-2H-furan-5-yl]methyl benzoate (PubChem CID 118081965) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is [(2R,5R)-5-ethynyl-2-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)-2H-furan-5-yl]methyl benzoate.
| Compound Name | [(2R,5R)-5-ethynyl-2-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)-2H-furan-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 118081965 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [(2R,5R)-5-ethynyl-2-(5-methyl-4-methylidene-2-oxopyrimidin-1-yl)-2H-furan-5-yl]methyl benzoate |
| SMILES | C#C[C@@]1(COC(=O)c2ccccc2)C=C[C@H](N2C=C(C)C(=C)NC2=O)O1 |
| InChI | InChI=1S/C20H18N2O4/c1-4-20(13-25-18(23)16-8-6-5-7-9-16)11-10-17(26-20)22-12-14(2)15(3)21-19(22)24/h1,5-12,17H,3,13H2,2H3,(H,21,24)/t17-,20+/m1/s1 |
| InChIKey | SINCYXCHMOYBSR-XLIONFOSSA-N |
| XLogP | 2.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|