C26H24N2O5 — CID 144735092
[5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methyl 4-phenylbenzoate (PubChem CID 144735092) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is [5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methyl 4-phenylbenzoate.
| Compound Name | [5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 144735092 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [5-ethynyl-2-[[(Z)-3-formamido-2-methyl-3-oxoprop-1-enyl]-methylamino]-2H-furan-5-yl]methyl 4-phenylbenzoate |
| SMILES | C#CC1(COC(=O)c2ccc(-c3ccccc3)cc2)C=CC(N(C)/C=C(/C)C(=O)NC=O)O1 |
| InChI | InChI=1S/C26H24N2O5/c1-4-26(15-14-23(33-26)28(3)16-19(2)24(30)27-18-29)17-32-25(31)22-12-10-21(11-13-22)20-8-6-5-7-9-20/h1,5-16,18,23H,17H2,2-3H3,(H,27,29,30)/b19-16- |
| InChIKey | AMTDLZKGUIDOIV-MNDPQUGUSA-N |
| XLogP | 2.90 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|