C24H26N2O5 — CID 144735087
[5-[formylcarbamoyl(2-methylprop-1-enyl)amino]oxolan-2-yl]methyl 4-phenylbenzoate (PubChem CID 144735087) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [5-[formylcarbamoyl(2-methylprop-1-enyl)amino]oxolan-2-yl]methyl 4-phenylbenzoate.
| Compound Name | [5-[formylcarbamoyl(2-methylprop-1-enyl)amino]oxolan-2-yl]methyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 144735087 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [5-[formylcarbamoyl(2-methylprop-1-enyl)amino]oxolan-2-yl]methyl 4-phenylbenzoate |
| SMILES | CC(C)=CN(C(=O)NC=O)C1CCC(COC(=O)c2ccc(-c3ccccc3)cc2)O1 |
| InChI | InChI=1S/C24H26N2O5/c1-17(2)14-26(24(29)25-16-27)22-13-12-21(31-22)15-30-23(28)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-11,14,16,21-22H,12-13,15H2,1-2H3,(H,25,27,29) |
| InChIKey | AOKRULVMEPGCJP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|