About methylsulfanyl 4-phenylbenzoate
methylsulfanyl 4-phenylbenzoate (PubChem CID 91284113) has the molecular formula C14H12O2S
and a molecular weight of 244.31 g/mol. Its IUPAC name is methylsulfanyl 4-phenylbenzoate.
Molecular Properties
| Compound Name | methylsulfanyl 4-phenylbenzoate |
| PubChem CID | 91284113 |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | methylsulfanyl 4-phenylbenzoate |
| SMILES | CSOC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2S/c1-17-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3 |
| InChIKey | PDDYJMZXPBCBKS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanyl 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanyl 4-phenylbenzoate?
The IUPAC name of methylsulfanyl 4-phenylbenzoate (CID 91284113) is methylsulfanyl 4-phenylbenzoate.
What is the SMILES notation for methylsulfanyl 4-phenylbenzoate?
The canonical SMILES for methylsulfanyl 4-phenylbenzoate is CSOC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of methylsulfanyl 4-phenylbenzoate?
The InChIKey is PDDYJMZXPBCBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2S/c1-17-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-10H,1H3.
What are the key properties of methylsulfanyl 4-phenylbenzoate?
methylsulfanyl 4-phenylbenzoate has a molecular weight of 244.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanyl 4-phenylbenzoate is sourced from PubChem (CID 91284113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).