C30H35N3O4Si — CID 10554201
N-[1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 10554201) has the molecular formula C30H35N3O4Si and a molecular weight of 529.71 g/mol. Its IUPAC name is N-[1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 10554201 |
| Molecular Formula | C30H35N3O4Si |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-[1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-prop-2-enyl-2H-furan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | C=CC[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H](n2ccc(NC(C)=O)nc2=O)O1 |
| InChI | InChI=1S/C30H35N3O4Si/c1-6-19-30(20-17-27(37-30)33-21-18-26(31-23(2)34)32-28(33)35)22-36-38(29(3,4)5,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h6-18,20-21,27H,1,19,22H2,2-5H3,(H,31,32,34,35)/t27-,30+/m1/s1 |
| InChIKey | PFRLGSPRKRNTMT-OFSOJUDTSA-N |
| XLogP | 4.18 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|