C42H55N3O4SSi — CID 134929680
N-[1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2,4,6-tri(propan-2-yl)phenyl]sulfanyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide (PubChem CID 134929680) has the molecular formula C42H55N3O4SSi and a molecular weight of 726.07 g/mol. Its IUPAC name is N-[1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2,4,6-tri(propan-2-yl)phenyl]sulfanyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2,4,6-tri(propan-2-yl)phenyl]sulfanyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 134929680 |
| Molecular Formula | C42H55N3O4SSi |
| Molecular Weight | 726.07 g/mol |
| Exact Mass | 725.37 |
| IUPAC Name | N-[1-[(2R,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[2,4,6-tri(propan-2-yl)phenyl]sulfanyloxolan-2-yl]-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ccn([C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2Sc2c(C(C)C)cc(C(C)C)cc2C(C)C)c(=O)n1 |
| InChI | InChI=1S/C42H55N3O4SSi/c1-27(2)31-23-35(28(3)4)39(36(24-31)29(5)6)50-37-25-32(49-40(37)45-22-21-38(43-30(7)46)44-41(45)47)26-48-51(42(8,9)10,33-17-13-11-14-18-33)34-19-15-12-16-20-34/h11-24,27-29,32,37,40H,25-26H2,1-10H3,(H,43,44,46,47)/t32-,37+,40+/m0/s1 |
| InChIKey | ICSCOUXEATYTHG-IKYRESLASA-N |
| XLogP | 8.60 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.07 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|