C34H40FN3O3SeSi — CID 10675901
1-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one (PubChem CID 10675901) has the molecular formula C34H40FN3O3SeSi and a molecular weight of 664.76 g/mol. Its IUPAC name is 1-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one.
| Compound Name | 1-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 10675901 |
| Molecular Formula | C34H40FN3O3SeSi |
| Molecular Weight | 664.76 g/mol |
| Exact Mass | 665.20 |
| IUPAC Name | 1-[(3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one |
| SMILES | CC(C)Nc1nc(=O)n(C2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H]2[Se]c2ccccc2)cc1F |
| InChI | InChI=1S/C34H40FN3O3SeSi/c1-24(2)36-31-29(35)22-38(33(39)37-31)32-30(42-26-15-9-6-10-16-26)21-25(41-32)23-40-43(34(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,22,24-25,30,32H,21,23H2,1-5H3,(H,36,37,39)/t25-,30+,32?/m0/s1 |
| InChIKey | NUUXQXNZUIVOMW-YLSFYXKXSA-N |
| XLogP | 4.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.76 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|