C28H34FN3O3Si — CID 10839348
1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one (PubChem CID 10839348) has the molecular formula C28H34FN3O3Si and a molecular weight of 507.68 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 10839348 |
| Molecular Formula | C28H34FN3O3Si |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5-dihydrofuran-2-yl]-5-fluoro-4-(propan-2-ylamino)pyrimidin-2-one |
| SMILES | CC(C)Nc1nc(=O)n([C@H]2C=C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)cc1F |
| InChI | InChI=1S/C28H34FN3O3Si/c1-20(2)30-26-24(29)18-32(27(33)31-26)25-17-16-21(35-25)19-34-36(28(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-18,20-21,25H,19H2,1-5H3,(H,30,31,33)/t21-,25+/m0/s1 |
| InChIKey | WPVMIKCZVGDGJO-SQJMNOBHSA-N |
| XLogP | 4.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|