C26H30FN3O4SSi — CID 56626942
N-[1-[(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-4-yl]-5-fluoro-2-oxopyrimidin-4-yl]acetamide (PubChem CID 56626942) has the molecular formula C26H30FN3O4SSi and a molecular weight of 527.69 g/mol. Its IUPAC name is N-[1-[(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-4-yl]-5-fluoro-2-oxopyrimidin-4-yl]acetamide.
| Compound Name | N-[1-[(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-4-yl]-5-fluoro-2-oxopyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 56626942 |
| Molecular Formula | C26H30FN3O4SSi |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | N-[1-[(2R,4S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-4-yl]-5-fluoro-2-oxopyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1nc(=O)n([C@@H]2CO[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)S2)cc1F |
| InChI | InChI=1S/C26H30FN3O4SSi/c1-18(31)28-24-21(27)15-30(25(32)29-24)22-16-33-23(35-22)17-34-36(26(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-15,22-23H,16-17H2,1-4H3,(H,28,29,31,32)/t22-,23+/m0/s1 |
| InChIKey | VIBRHXQZYOWFMY-XZOQPEGZSA-N |
| XLogP | 3.51 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|