C38H44O2Si — CID 122383866
[(2R,3S,6S)-2,3-bis(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 122383866) has the molecular formula C38H44O2Si and a molecular weight of 560.85 g/mol. Its IUPAC name is [(2R,3S,6S)-2,3-bis(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,3S,6S)-2,3-bis(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 122383866 |
| Molecular Formula | C38H44O2Si |
| Molecular Weight | 560.85 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | [(2R,3S,6S)-2,3-bis(3,5-dimethylphenyl)-3,6-dihydro-2H-pyran-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | Cc1cc(C)cc([C@@H]2C=C[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O[C@H]2c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C38H44O2Si/c1-27-20-28(2)23-31(22-27)36-19-18-33(40-37(36)32-24-29(3)21-30(4)25-32)26-39-41(38(5,6)7,34-14-10-8-11-15-34)35-16-12-9-13-17-35/h8-25,33,36-37H,26H2,1-7H3/t33-,36-,37-/m0/s1 |
| InChIKey | UWRIJGWJZAUHKX-WOFUPGFCSA-N |
| XLogP | 8.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.85 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|