C32H36O5SSi — CID 101038658
(3R,6S)-2-[1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 101038658) has the molecular formula C32H36O5SSi and a molecular weight of 560.79 g/mol. Its IUPAC name is (3R,6S)-2-[1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (3R,6S)-2-[1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 101038658 |
| Molecular Formula | C32H36O5SSi |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | (3R,6S)-2-[1-(benzenesulfonyl)but-3-yn-2-yl]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C#CC(CS(=O)(=O)c1ccccc1)C1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H]1O |
| InChI | InChI=1S/C32H36O5SSi/c1-5-25(24-38(34,35)27-15-9-6-10-16-27)31-30(33)22-21-26(37-31)23-36-39(32(2,3)4,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h1,6-22,25-26,30-31,33H,23-24H2,2-4H3/t25?,26-,30+,31?/m0/s1 |
| InChIKey | JODUYNYKDRHHCO-DVXUYQPTSA-N |
| XLogP | 3.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|