C39H44O2S5Si2 — CID 23635439
(5S,6R)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione (PubChem CID 23635439) has the molecular formula C39H44O2S5Si2 and a molecular weight of 761.29 g/mol. Its IUPAC name is (5S,6R)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione.
| Compound Name | (5S,6R)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
|---|---|
| PubChem CID | 23635439 |
| Molecular Formula | C39H44O2S5Si2 |
| Molecular Weight | 761.29 g/mol |
| Exact Mass | 760.15 |
| IUPAC Name | (5S,6R)-5,6-bis[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine-2-thione |
| SMILES | CC(C)(C)[Si](OC[C@@H]1Sc2sc(=S)sc2S[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H44O2S5Si2/c1-38(2,3)47(29-19-11-7-12-20-29,30-21-13-8-14-22-30)40-27-33-34(44-36-35(43-33)45-37(42)46-36)28-41-48(39(4,5)6,31-23-15-9-16-24-31)32-25-17-10-18-26-32/h7-26,33-34H,27-28H2,1-6H3/t33-,34+ |
| InChIKey | SJUKTRCNDRZVAN-AQOUDTPCSA-N |
| XLogP | 9.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.29 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|