C28H34FN5O6 — CID 164828744
[(2R,3S,5R)-2-(1-adamantylmethoxycarbonyloxymethyl)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-3-yl] 2-methylpropanoate (PubChem CID 164828744) has the molecular formula C28H34FN5O6 and a molecular weight of 555.61 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(1-adamantylmethoxycarbonyloxymethyl)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,5R)-2-(1-adamantylmethoxycarbonyloxymethyl)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 164828744 |
| Molecular Formula | C28H34FN5O6 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | [(2R,3S,5R)-2-(1-adamantylmethoxycarbonyloxymethyl)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-3-yl] 2-methylpropanoate |
| SMILES | C#C[C@]1(COC(=O)OCC23CC4CC(CC(C4)C2)C3)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C28H34FN5O6/c1-4-28(13-38-26(36)37-12-27-9-16-5-17(10-27)7-18(6-16)11-27)19(39-24(35)15(2)3)8-20(40-28)34-14-31-21-22(30)32-25(29)33-23(21)34/h1,14-20H,5-13H2,2-3H3,(H2,30,32,33)/t16?,17?,18?,19-,20+,27?,28+/m0/s1 |
| InChIKey | ZYSBDMLSKUBMQS-DAFMEQGVSA-N |
| XLogP | 3.78 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|