C38H48FN5O7 — CID 164828753
[(2R,3S,5R)-3-[2-(1-adamantyl)ethoxycarbonyloxy]-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl 2-(1-adamantyl)ethyl carbonate (PubChem CID 164828753) has the molecular formula C38H48FN5O7 and a molecular weight of 705.83 g/mol. Its IUPAC name is [(2R,3S,5R)-3-[2-(1-adamantyl)ethoxycarbonyloxy]-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl 2-(1-adamantyl)ethyl carbonate.
| Compound Name | [(2R,3S,5R)-3-[2-(1-adamantyl)ethoxycarbonyloxy]-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl 2-(1-adamantyl)ethyl carbonate |
|---|---|
| PubChem CID | 164828753 |
| Molecular Formula | C38H48FN5O7 |
| Molecular Weight | 705.83 g/mol |
| Exact Mass | 705.35 |
| IUPAC Name | [(2R,3S,5R)-3-[2-(1-adamantyl)ethoxycarbonyloxy]-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyloxolan-2-yl]methyl 2-(1-adamantyl)ethyl carbonate |
| SMILES | C#C[C@]1(COC(=O)OCCC23CC4CC(CC(C4)C2)C3)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C38H48FN5O7/c1-2-38(20-49-34(45)47-5-3-36-14-22-7-23(15-36)9-24(8-22)16-36)28(13-29(51-38)44-21-41-30-31(40)42-33(39)43-32(30)44)50-35(46)48-6-4-37-17-25-10-26(18-37)12-27(11-25)19-37/h1,21-29H,3-20H2,(H2,40,42,43)/t22?,23?,24?,25?,26?,27?,28-,29+,36?,37?,38+/m0/s1 |
| InChIKey | NZRLDGYKGSGQOW-SNJHVVKSSA-N |
| XLogP | 6.73 |
| TPSA | 149.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.83 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|