C27H36FN5O6 — CID 167223683
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(3,3-diethylhex-5-enoxycarbonyloxymethyl)-2-ethynyloxolan-3-yl] 2-methylpropanoate (PubChem CID 167223683) has the molecular formula C27H36FN5O6 and a molecular weight of 545.61 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(3,3-diethylhex-5-enoxycarbonyloxymethyl)-2-ethynyloxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(3,3-diethylhex-5-enoxycarbonyloxymethyl)-2-ethynyloxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 167223683 |
| Molecular Formula | C27H36FN5O6 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-(3,3-diethylhex-5-enoxycarbonyloxymethyl)-2-ethynyloxolan-3-yl] 2-methylpropanoate |
| SMILES | C#C[C@]1(COC(=O)OCCC(CC)(CC)CC=C)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C27H36FN5O6/c1-7-11-26(8-2,9-3)12-13-36-25(35)37-15-27(10-4)18(38-23(34)17(5)6)14-19(39-27)33-16-30-20-21(29)31-24(28)32-22(20)33/h4,7,16-19H,1,8-9,11-15H2,2-3,5-6H3,(H2,29,31,32)/t18-,19+,27+/m0/s1 |
| InChIKey | DLOAUMNGLYIIPK-DSNGTPCMSA-N |
| XLogP | 4.33 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|