C21H26FN5O5 — CID 155685106
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-5-methyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate (PubChem CID 155685106) has the molecular formula C21H26FN5O5 and a molecular weight of 447.47 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-5-methyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-5-methyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 155685106 |
| Molecular Formula | C21H26FN5O5 |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-5-methyl-3-propanoyloxyoxolan-2-yl]methyl pentanoate |
| SMILES | C#C[C@]1(COC(=O)CCCC)O[C@@](C)(n2cnc3c(N)nc(F)nc32)C[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C21H26FN5O5/c1-5-8-9-15(29)30-11-21(7-3)13(31-14(28)6-2)10-20(4,32-21)27-12-24-16-17(23)25-19(22)26-18(16)27/h3,12-13H,5-6,8-11H2,1-2,4H3,(H2,23,25,26)/t13-,20+,21+/m0/s1 |
| InChIKey | BKUDMIPJRLTXJC-JDORSLCVSA-N |
| XLogP | 2.07 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|