C26H28F2N10O4 — CID 167586343
(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol;9-[(2R,4S,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]-2-fluoropurin-6-amine (PubChem CID 167586343) has the molecular formula C26H28F2N10O4 and a molecular weight of 582.57 g/mol. Its IUPAC name is (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol;9-[(2R,4S,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]-2-fluoropurin-6-amine.
| Compound Name | (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol;9-[(2R,4S,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 167586343 |
| Molecular Formula | C26H28F2N10O4 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | (2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol;9-[(2R,4S,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]-2-fluoropurin-6-amine |
| SMILES | C#C[C@]1(CC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1C.C#C[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C14H16FN5O.C12H12FN5O3/c1-4-14(5-2)8(3)6-9(21-14)20-7-17-10-11(16)18-13(15)19-12(10)20;1-2-12(4-19)6(20)3-7(21-12)18-5-15-8-9(14)16-11(13)17-10(8)18/h1,7-9H,5-6H2,2-3H3,(H2,16,18,19);1,5-7,19-20H,3-4H2,(H2,14,16,17)/t8-,9+,14+;6-,7+,12+/m00/s1 |
| InChIKey | HVVQCGWHJWGPSN-DAPVKQIMSA-N |
| XLogP | 1.08 |
| TPSA | 198.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|