C15H16FN5O3 — CID 176809375
(2R,3S,5S)-5-[6-(cyclopropylamino)-2-fluoropurin-9-yl]-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 176809375) has the molecular formula C15H16FN5O3 and a molecular weight of 333.32 g/mol. Its IUPAC name is (2R,3S,5S)-5-[6-(cyclopropylamino)-2-fluoropurin-9-yl]-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-[6-(cyclopropylamino)-2-fluoropurin-9-yl]-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 176809375 |
| Molecular Formula | C15H16FN5O3 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (2R,3S,5S)-5-[6-(cyclopropylamino)-2-fluoropurin-9-yl]-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#C[C@]1(CO)O[C@H](n2cnc3c(NC4CC4)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C15H16FN5O3/c1-2-15(6-22)9(23)5-10(24-15)21-7-17-11-12(18-8-3-4-8)19-14(16)20-13(11)21/h1,7-10,22-23H,3-6H2,(H,18,19,20)/t9-,10-,15+/m0/s1 |
| InChIKey | MCHWANWVEYHKEJ-AMJWSMQMSA-N |
| XLogP | 0.18 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|