C16H18FN5O5 — CID 155596836
propan-2-yl N-[9-[(2R,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamate (PubChem CID 155596836) has the molecular formula C16H18FN5O5 and a molecular weight of 379.35 g/mol. Its IUPAC name is propan-2-yl N-[9-[(2R,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamate.
| Compound Name | propan-2-yl N-[9-[(2R,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamate |
|---|---|
| PubChem CID | 155596836 |
| Molecular Formula | C16H18FN5O5 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | propan-2-yl N-[9-[(2R,4S,5R)-5-ethynyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamate |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(NC(=O)OC(C)C)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C16H18FN5O5/c1-4-16(6-23)9(24)5-10(27-16)22-7-18-11-12(19-14(17)21-13(11)22)20-15(25)26-8(2)3/h1,7-10,23-24H,5-6H2,2-3H3,(H,19,20,21,25)/t9-,10+,16+/m0/s1 |
| InChIKey | NYVFUDDEGNRHLG-YNHOBRIKSA-N |
| XLogP | 0.57 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|