C36H54FN5O9 — CID 156644132
[2-[[9-[(2R,4S,5R)-4-acetyloxy-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamoyloxy]-3-nonoxypropyl] nonanoate (PubChem CID 156644132) has the molecular formula C36H54FN5O9 and a molecular weight of 719.85 g/mol. Its IUPAC name is [2-[[9-[(2R,4S,5R)-4-acetyloxy-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamoyloxy]-3-nonoxypropyl] nonanoate.
| Compound Name | [2-[[9-[(2R,4S,5R)-4-acetyloxy-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamoyloxy]-3-nonoxypropyl] nonanoate |
|---|---|
| PubChem CID | 156644132 |
| Molecular Formula | C36H54FN5O9 |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.39 |
| IUPAC Name | [2-[[9-[(2R,4S,5R)-4-acetyloxy-5-ethynyl-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]carbamoyloxy]-3-nonoxypropyl] nonanoate |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(NC(=O)OC(COCCCCCCCCC)COC(=O)CCCCCCCC)nc(F)nc32)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C36H54FN5O9/c1-5-8-10-12-14-16-18-20-47-22-27(23-48-30(45)19-17-15-13-11-9-6-2)50-35(46)40-32-31-33(41-34(37)39-32)42(25-38-31)29-21-28(49-26(4)44)36(7-3,24-43)51-29/h3,25,27-29,43H,5-6,8-24H2,1-2,4H3,(H,39,40,41,46)/t27?,28-,29+,36+/m0/s1 |
| InChIKey | NLJLJYUJBGXVMB-QIURIQJMSA-N |
| XLogP | 6.16 |
| TPSA | 173.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|