C29H40N12O3 — CID 160922083
(2R,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyl-5-ethynyl-4-methyloxolan-3-ol;9-[(2R,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]purine-2,6-diamine;methane (PubChem CID 160922083) has the molecular formula C29H40N12O3 and a molecular weight of 604.72 g/mol. Its IUPAC name is (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyl-5-ethynyl-4-methyloxolan-3-ol;9-[(2R,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]purine-2,6-diamine;methane.
| Compound Name | (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyl-5-ethynyl-4-methyloxolan-3-ol;9-[(2R,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]purine-2,6-diamine;methane |
|---|---|
| PubChem CID | 160922083 |
| Molecular Formula | C29H40N12O3 |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.33 |
| IUPAC Name | (2R,5R)-2-(2,6-diaminopurin-9-yl)-5-ethyl-5-ethynyl-4-methyloxolan-3-ol;9-[(2R,5R)-5-ethyl-5-ethynyl-4-methyloxolan-2-yl]purine-2,6-diamine;methane |
| SMILES | C.C#C[C@]1(CC)O[C@@H](n2cnc3c(N)nc(N)nc32)C(O)C1C.C#C[C@]1(CC)O[C@@H](n2cnc3c(N)nc(N)nc32)CC1C |
| InChI | InChI=1S/C14H18N6O2.C14H18N6O.CH4/c1-4-14(5-2)7(3)9(21)12(22-14)20-6-17-8-10(15)18-13(16)19-11(8)20;1-4-14(5-2)8(3)6-9(21-14)20-7-17-10-11(15)18-13(16)19-12(10)20;/h1,6-7,9,12,21H,5H2,2-3H3,(H4,15,16,18,19);1,7-9H,5-6H2,2-3H3,(H4,15,16,18,19);1H4/t7?,9?,12-,14-;8?,9-,14-;/m11./s1 |
| InChIKey | SSDXGIZAWRXYNS-NJYSAKSMSA-N |
| XLogP | 2.26 |
| TPSA | 229.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|