C16H19F2N5O3 — CID 176740789
5-(6-amino-2-fluoropurin-9-yl)-2-(butoxymethyl)-2-ethynyl-4-fluorooxolan-3-ol (PubChem CID 176740789) has the molecular formula C16H19F2N5O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-(6-amino-2-fluoropurin-9-yl)-2-(butoxymethyl)-2-ethynyl-4-fluorooxolan-3-ol.
| Compound Name | 5-(6-amino-2-fluoropurin-9-yl)-2-(butoxymethyl)-2-ethynyl-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 176740789 |
| Molecular Formula | C16H19F2N5O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 5-(6-amino-2-fluoropurin-9-yl)-2-(butoxymethyl)-2-ethynyl-4-fluorooxolan-3-ol |
| SMILES | C#CC1(COCCCC)OC(n2cnc3c(N)nc(F)nc32)C(F)C1O |
| InChI | InChI=1S/C16H19F2N5O3/c1-3-5-6-25-7-16(4-2)11(24)9(17)14(26-16)23-8-20-10-12(19)21-15(18)22-13(10)23/h2,8-9,11,14,24H,3,5-7H2,1H3,(H2,19,21,22) |
| InChIKey | SOSHEQZPBNAUST-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|