C30H37N6O10P — CID 88925922
[[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] (2S)-2-[cyclohexyloxy(naphthalen-1-yl)amino]propanoate (PubChem CID 88925922) has the molecular formula C30H37N6O10P and a molecular weight of 672.63 g/mol. Its IUPAC name is [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] (2S)-2-[cyclohexyloxy(naphthalen-1-yl)amino]propanoate.
| Compound Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] (2S)-2-[cyclohexyloxy(naphthalen-1-yl)amino]propanoate |
|---|---|
| PubChem CID | 88925922 |
| Molecular Formula | C30H37N6O10P |
| Molecular Weight | 672.63 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | [[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] (2S)-2-[cyclohexyloxy(naphthalen-1-yl)amino]propanoate |
| SMILES | COC(OP(=O)(O)OC(=O)[C@H](C)N(OC1CCCCC1)c1cccc2ccccc12)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H37N6O10P/c1-17(36(44-19-11-4-3-5-12-19)21-14-8-10-18-9-6-7-13-20(18)21)29(39)45-47(40,41)46-30(42-2)25-23(37)24(38)28(43-25)35-16-34-22-26(31)32-15-33-27(22)35/h6-10,13-17,19,23-25,28,30,37-38H,3-5,11-12H2,1-2H3,(H,40,41)(H2,31,32,33)/t17-,23-,24+,25-,28+,30?/m0/s1 |
| InChIKey | QHIODQILLDIUFI-OBWCYTBHSA-N |
| XLogP | 2.97 |
| TPSA | 213.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|