C22H26N5O7P — CID 101142303
[(3S,4R,5R)-5-(6-benzamidopurin-9-yl)-4-methoxy-2-methylideneoxolan-3-yl] diethyl phosphate (PubChem CID 101142303) has the molecular formula C22H26N5O7P and a molecular weight of 504.45 g/mol. Its IUPAC name is [(3S,4R,5R)-5-(6-benzamidopurin-9-yl)-4-methoxy-2-methylideneoxolan-3-yl] diethyl phosphate.
| Compound Name | [(3S,4R,5R)-5-(6-benzamidopurin-9-yl)-4-methoxy-2-methylideneoxolan-3-yl] diethyl phosphate |
|---|---|
| PubChem CID | 101142303 |
| Molecular Formula | C22H26N5O7P |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [(3S,4R,5R)-5-(6-benzamidopurin-9-yl)-4-methoxy-2-methylideneoxolan-3-yl] diethyl phosphate |
| SMILES | C=C1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@H](OC)[C@@H]1OP(=[17O])(OCC)OCC |
| InChI | InChI=1S/C22H26N5O7P/c1-5-31-35(29,32-6-2)34-17-14(3)33-22(18(17)30-4)27-13-25-16-19(23-12-24-20(16)27)26-21(28)15-10-8-7-9-11-15/h7-13,17-18,22H,3,5-6H2,1-2,4H3,(H,23,24,26,28)/t17-,18-,22-/m1/s1/i29+1 |
| InChIKey | VICMGUNOSABJAK-KTZWEBKDSA-N |
| XLogP | 3.70 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|