C24H34N6O4 — CID 70882161
(4R,6S)-4-[6-(cyclohexylamino)purin-9-yl]-N-ethylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide (PubChem CID 70882161) has the molecular formula C24H34N6O4 and a molecular weight of 470.57 g/mol. Its IUPAC name is (4R,6S)-4-[6-(cyclohexylamino)purin-9-yl]-N-ethylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide.
| Compound Name | (4R,6S)-4-[6-(cyclohexylamino)purin-9-yl]-N-ethylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
|---|---|
| PubChem CID | 70882161 |
| Molecular Formula | C24H34N6O4 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (4R,6S)-4-[6-(cyclohexylamino)purin-9-yl]-N-ethylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC4CCCCC4)ncnc32)C2OC3(CCCCC3)OC21 |
| InChI | InChI=1S/C24H34N6O4/c1-2-25-22(31)18-17-19(34-24(33-17)11-7-4-8-12-24)23(32-18)30-14-28-16-20(26-13-27-21(16)30)29-15-9-5-3-6-10-15/h13-15,17-19,23H,2-12H2,1H3,(H,25,31)(H,26,27,29)/t17?,18-,19?,23+/m0/s1 |
| InChIKey | RZWNZKSNNTVDMA-VWTPQDEDSA-N |
| XLogP | 3.05 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |