C24H32N6O5 — CID 59373215
1-[9-[(4R,6S,6aR)-6-acetylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea (PubChem CID 59373215) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-[9-[(4R,6S,6aR)-6-acetylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea.
| Compound Name | 1-[9-[(4R,6S,6aR)-6-acetylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 59373215 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 1-[9-[(4R,6S,6aR)-6-acetylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-4-yl]purin-6-yl]-3-cyclohexylurea |
| SMILES | CC(=O)[C@H]1O[C@@H](n2cnc3c(NC(=O)NC4CCCCC4)ncnc32)C2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C24H32N6O5/c1-14(31)17-18-19(35-24(34-18)10-6-3-7-11-24)22(33-17)30-13-27-16-20(25-12-26-21(16)30)29-23(32)28-15-8-4-2-5-9-15/h12-13,15,17-19,22H,2-11H2,1H3,(H2,25,26,28,29,32)/t17-,18+,19?,22-/m1/s1 |
| InChIKey | DCCSVVHFKRBJQR-JVXMTQNBSA-N |
| XLogP | 3.21 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |