C26H32N6O5 — CID 46836485
(3aR,4R,6S,6aS)-N-(2-hydroxyethyl)-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide (PubChem CID 46836485) has the molecular formula C26H32N6O5 and a molecular weight of 508.58 g/mol. Its IUPAC name is (3aR,4R,6S,6aS)-N-(2-hydroxyethyl)-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide.
| Compound Name | (3aR,4R,6S,6aS)-N-(2-hydroxyethyl)-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
|---|---|
| PubChem CID | 46836485 |
| Molecular Formula | C26H32N6O5 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (3aR,4R,6S,6aS)-N-(2-hydroxyethyl)-4-[6-(2-phenylethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-carboxamide |
| SMILES | O=C(NCCO)[C@H]1O[C@@H](n2cnc3c(NCCc4ccccc4)ncnc32)[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C26H32N6O5/c33-14-13-28-24(34)20-19-21(37-26(36-19)10-5-2-6-11-26)25(35-20)32-16-31-18-22(29-15-30-23(18)32)27-12-9-17-7-3-1-4-8-17/h1,3-4,7-8,15-16,19-21,25,33H,2,5-6,9-14H2,(H,28,34)(H,27,29,30)/t19-,20+,21-,25-/m1/s1 |
| InChIKey | WQVMEJDXIUFCDP-FBROZUCGSA-N |
| XLogP | 1.93 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |