C27H37N5O4 — CID 59373252
[(3aS,4R,6R)-4-[6-(1-adamantylmethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methanol (PubChem CID 59373252) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is [(3aS,4R,6R)-4-[6-(1-adamantylmethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methanol.
| Compound Name | [(3aS,4R,6R)-4-[6-(1-adamantylmethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methanol |
|---|---|
| PubChem CID | 59373252 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | [(3aS,4R,6R)-4-[6-(1-adamantylmethylamino)purin-9-yl]spiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclohexane]-6-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCC45CC6CC(CC(C6)C4)C5)ncnc32)[C@H]2OC3(CCCCC3)OC12 |
| InChI | InChI=1S/C27H37N5O4/c33-12-19-21-22(36-27(35-21)4-2-1-3-5-27)25(34-19)32-15-31-20-23(29-14-30-24(20)32)28-13-26-9-16-6-17(10-26)8-18(7-16)11-26/h14-19,21-22,25,33H,1-13H2,(H,28,29,30)/t16?,17?,18?,19-,21?,22+,25-,26?/m1/s1 |
| InChIKey | AJALBTSTIIPHSH-KCKOZGMUSA-N |
| XLogP | 3.79 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |