C25H23N5O4 — CID 70882185
[(4'R,6'R)-4'-(6-anilinopurin-9-yl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-yl]methanol (PubChem CID 70882185) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is [(4'R,6'R)-4'-(6-anilinopurin-9-yl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-yl]methanol.
| Compound Name | [(4'R,6'R)-4'-(6-anilinopurin-9-yl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-yl]methanol |
|---|---|
| PubChem CID | 70882185 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [(4'R,6'R)-4'-(6-anilinopurin-9-yl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-yl]methanol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(Nc4ccccc4)ncnc32)C2OC3(Cc4ccccc4C3)OC21 |
| InChI | InChI=1S/C25H23N5O4/c31-12-18-20-21(34-25(33-20)10-15-6-4-5-7-16(15)11-25)24(32-18)30-14-28-19-22(26-13-27-23(19)30)29-17-8-2-1-3-9-17/h1-9,13-14,18,20-21,24,31H,10-12H2,(H,26,27,29)/t18-,20?,21?,24-/m1/s1 |
| InChIKey | QRVXRWKQFPNZIA-LBQDIGMFSA-N |
| XLogP | 2.74 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |