C30H34N6O5 — CID 70882151
1-(1-adamantyl)-3-[9-[(4'R,6'R)-6'-(hydroxymethyl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-4'-yl]purin-6-yl]urea (PubChem CID 70882151) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[9-[(4'R,6'R)-6'-(hydroxymethyl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-4'-yl]purin-6-yl]urea.
| Compound Name | 1-(1-adamantyl)-3-[9-[(4'R,6'R)-6'-(hydroxymethyl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-4'-yl]purin-6-yl]urea |
|---|---|
| PubChem CID | 70882151 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 1-(1-adamantyl)-3-[9-[(4'R,6'R)-6'-(hydroxymethyl)spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-4'-yl]purin-6-yl]urea |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C2OC3(Cc4ccccc4C3)OC21)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H34N6O5/c37-13-21-23-24(41-30(40-23)11-19-3-1-2-4-20(19)12-30)27(39-21)36-15-33-22-25(31-14-32-26(22)36)34-28(38)35-29-8-16-5-17(9-29)7-18(6-16)10-29/h1-4,14-18,21,23-24,27,37H,5-13H2,(H2,31,32,34,35,38)/t16?,17?,18?,21-,23?,24?,27-,29?/m1/s1 |
| InChIKey | FXNIDMCKJINMHT-RFYMIXKASA-N |
| XLogP | 3.09 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |