C26H28N6O6 — CID 46836702
(3'aR,4'R,6'S,6'aS)-4'-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-carboxylic acid (PubChem CID 46836702) has the molecular formula C26H28N6O6 and a molecular weight of 520.55 g/mol. Its IUPAC name is (3'aR,4'R,6'S,6'aS)-4'-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-carboxylic acid.
| Compound Name | (3'aR,4'R,6'S,6'aS)-4'-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-carboxylic acid |
|---|---|
| PubChem CID | 46836702 |
| Molecular Formula | C26H28N6O6 |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | (3'aR,4'R,6'S,6'aS)-4'-[6-(cyclohexylcarbamoylamino)purin-9-yl]spiro[1,3-dihydroindene-2,2'-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole]-6'-carboxylic acid |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)O)[C@H]2OC3(Cc4ccccc4C3)O[C@H]21)NC1CCCCC1 |
| InChI | InChI=1S/C26H28N6O6/c33-24(34)20-18-19(38-26(37-18)10-14-6-4-5-7-15(14)11-26)23(36-20)32-13-29-17-21(27-12-28-22(17)32)31-25(35)30-16-8-2-1-3-9-16/h4-7,12-13,16,18-20,23H,1-3,8-11H2,(H,33,34)(H2,27,28,30,31,35)/t18-,19+,20-,23+/m0/s1 |
| InChIKey | ZSWXJJXEAIXFAS-FAKFISEUSA-N |
| XLogP | 2.54 |
| TPSA | 149.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |